About (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol
(2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol (PubChem CID 12038442) has the molecular formula C20H19ClO
and a molecular weight of 310.82 g/mol. Its IUPAC name is (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol.
Molecular Properties
| Compound Name | (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol |
| PubChem CID | 12038442 |
| Molecular Formula | C20H19ClO |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol |
| SMILES | C=C=C(C)C/C=C(\c1ccccc1)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClO/c1-3-15(2)9-14-19(16-7-5-4-6-8-16)20(22)17-10-12-18(21)13-11-17/h4-8,10-14,20,22H,1,9H2,2H3/b19-14+ |
| InChIKey | QADKUMCHHRNGCJ-XMHGGMMESA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol?
The IUPAC name of (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol (CID 12038442) is (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol.
What is the SMILES notation for (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol?
The canonical SMILES for (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol is C=C=C(C)C/C=C(\c1ccccc1)C(O)c1ccc(Cl)cc1.
What is the InChIKey of (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol?
The InChIKey is QADKUMCHHRNGCJ-XMHGGMMESA-N. The full InChI is InChI=1S/C20H19ClO/c1-3-15(2)9-14-19(16-7-5-4-6-8-16)20(22)17-10-12-18(21)13-11-17/h4-8,10-14,20,22H,1,9H2,2H3/b19-14+.
What are the key properties of (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol?
(2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol has a molecular weight of 310.82 g/mol, XLogP of 5.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1-(4-chlorophenyl)-5-methyl-2-phenylhepta-2,5,6-trien-1-ol is sourced from PubChem (CID 12038442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).