C42H64FNO11 — CID 12038492
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S)-2-(3-fluorophenyl)-4-oxopiperidin-1-yl]oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate (PubChem CID 12038492) has the molecular formula C42H64FNO11 and a molecular weight of 777.97 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S)-2-(3-fluorophenyl)-4-oxopiperidin-1-yl]oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S)-2-(3-fluorophenyl)-4-oxopiperidin-1-yl]oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 12038492 |
| Molecular Formula | C42H64FNO11 |
| Molecular Weight | 777.97 g/mol |
| Exact Mass | 777.45 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S)-2-(3-fluorophenyl)-4-oxopiperidin-1-yl]oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@@H](OC(=O)C(C)(C)C)[C@H](N2CCC(=O)C[C@H]2c2cccc(F)c2)O[C@H](COC(=O)C(C)(C)CCCCCCO)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C42H64FNO11/c1-39(2,3)35(47)53-31-30(25-51-38(50)42(10,11)20-14-12-13-15-22-45)52-34(44-21-19-28(46)24-29(44)26-17-16-18-27(43)23-26)33(55-37(49)41(7,8)9)32(31)54-36(48)40(4,5)6/h16-18,23,29-34,45H,12-15,19-22,24-25H2,1-11H3/t29-,30+,31-,32-,33+,34+/m0/s1 |
| InChIKey | RBZXZLZJMVYRDT-LMEWNJKNSA-N |
| XLogP | 6.64 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.97 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|