C17H18N2O — CID 12038541
1,4-dimethyl-6-phenyl-2,3-dihydro-1,4-benzodiazepin-5-one (PubChem CID 12038541) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1,4-dimethyl-6-phenyl-2,3-dihydro-1,4-benzodiazepin-5-one.
| Compound Name | 1,4-dimethyl-6-phenyl-2,3-dihydro-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 12038541 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1,4-dimethyl-6-phenyl-2,3-dihydro-1,4-benzodiazepin-5-one |
| SMILES | CN1CCN(C)c2cccc(-c3ccccc3)c2C1=O |
| InChI | InChI=1S/C17H18N2O/c1-18-11-12-19(2)17(20)16-14(9-6-10-15(16)18)13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3 |
| InChIKey | HZAQMKLGFPPUKE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |