C20H20NO4+ — CID 12039001
16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene (PubChem CID 12039001) has the molecular formula C20H20NO4+ and a molecular weight of 338.38 g/mol. Its IUPAC name is 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene.
| Compound Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene |
|---|---|
| PubChem CID | 12039001 |
| Molecular Formula | C20H20NO4+ |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,13,15(20),16,18-heptaene |
| SMILES | COc1ccc2c(c1OC)C=[N+]1CCc3cc4c(cc3C1C2)OCO4 |
| InChI | InChI=1S/C20H20NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,8-10,16H,5-7,11H2,1-2H3/q+1 |
| InChIKey | ZLAPRZXWXSADPR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|