C20H34O3 — CID 12039042
(1S,5R,8R,9E,11S,14S)-8,14-dimethyl-4-methylidene-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-9-ene-5,8-diol (PubChem CID 12039042) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1S,5R,8R,9E,11S,14S)-8,14-dimethyl-4-methylidene-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-9-ene-5,8-diol.
| Compound Name | (1S,5R,8R,9E,11S,14S)-8,14-dimethyl-4-methylidene-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-9-ene-5,8-diol |
|---|---|
| PubChem CID | 12039042 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1S,5R,8R,9E,11S,14S)-8,14-dimethyl-4-methylidene-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-9-ene-5,8-diol |
| SMILES | C=C1CC[C@@H]2O[C@@]2(C)CC[C@@H](C(C)C)/C=C/[C@](C)(O)CC[C@H]1O |
| InChI | InChI=1S/C20H34O3/c1-14(2)16-8-11-19(4,22)12-10-17(21)15(3)6-7-18-20(5,23-18)13-9-16/h8,11,14,16-18,21-22H,3,6-7,9-10,12-13H2,1-2,4-5H3/b11-8+/t16-,17+,18-,19-,20-/m0/s1 |
| InChIKey | DSDNGQDXKIINGX-UOWLIHAQSA-N |
| XLogP | 3.99 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|