C42H48N4O9 — CID 12039237
benzyl 2-[[(2R)-3-cyclohexyl-1-[(2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethylcarbamoyl]piperidin-1-yl]-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]acetate (PubChem CID 12039237) has the molecular formula C42H48N4O9 and a molecular weight of 752.87 g/mol. Its IUPAC name is benzyl 2-[[(2R)-3-cyclohexyl-1-[(2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethylcarbamoyl]piperidin-1-yl]-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]acetate.
| Compound Name | benzyl 2-[[(2R)-3-cyclohexyl-1-[(2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethylcarbamoyl]piperidin-1-yl]-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 12039237 |
| Molecular Formula | C42H48N4O9 |
| Molecular Weight | 752.87 g/mol |
| Exact Mass | 752.34 |
| IUPAC Name | benzyl 2-[[(2R)-3-cyclohexyl-1-[(2S)-2-[2-(1,3-dioxoisoindol-2-yl)oxyethylcarbamoyl]piperidin-1-yl]-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]acetate |
| SMILES | O=C(CN(C(=O)OCc1ccccc1)[C@H](CC1CCCCC1)C(=O)N1CCCC[C@H]1C(=O)NCCON1C(=O)c2ccccc2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C42H48N4O9/c47-37(53-28-31-16-6-2-7-17-31)27-45(42(52)54-29-32-18-8-3-9-19-32)36(26-30-14-4-1-5-15-30)41(51)44-24-13-12-22-35(44)38(48)43-23-25-55-46-39(49)33-20-10-11-21-34(33)40(46)50/h2-3,6-11,16-21,30,35-36H,1,4-5,12-15,22-29H2,(H,43,48)/t35-,36+/m0/s1 |
| InChIKey | GZLAKNQXKXLDOK-MPQUPPDSSA-N |
| XLogP | 5.43 |
| TPSA | 151.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.87 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|