C28H40O7SSi — CID 12039248
2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethyl methanesulfonate (PubChem CID 12039248) has the molecular formula C28H40O7SSi and a molecular weight of 548.77 g/mol. Its IUPAC name is 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethyl methanesulfonate.
| Compound Name | 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 12039248 |
| Molecular Formula | C28H40O7SSi |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]ethyl methanesulfonate |
| SMILES | CC1(C)OC[C@H]([C@H]2OC[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]2CCOS(C)(=O)=O)O1 |
| InChI | InChI=1S/C28H40O7SSi/c1-27(2,3)37(21-13-9-7-10-14-21,22-15-11-8-12-16-22)35-24-19-31-26(25-20-32-28(4,5)34-25)23(24)17-18-33-36(6,29)30/h7-16,23-26H,17-20H2,1-6H3/t23-,24-,25+,26-/m0/s1 |
| InChIKey | WJVQDLCBUCNWMT-SSUZURRFSA-N |
| XLogP | 3.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|