C20H26O6 — CID 12039271
[(3aS,7S,10Z,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 2-methylpropanoate (PubChem CID 12039271) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(3aS,7S,10Z,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 2-methylpropanoate.
| Compound Name | [(3aS,7S,10Z,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 12039271 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(3aS,7S,10Z,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 2-methylpropanoate |
| SMILES | C=C1C(=O)C[C@H]2C(=C)C(=O)O[C@@H]2/C=C(\COC(=O)C(C)C)CC[C@@H]1OC |
| InChI | InChI=1S/C20H26O6/c1-11(2)19(22)25-10-14-6-7-17(24-5)13(4)16(21)9-15-12(3)20(23)26-18(15)8-14/h8,11,15,17-18H,3-4,6-7,9-10H2,1-2,5H3/b14-8-/t15-,17-,18+/m0/s1 |
| InChIKey | YLBYHUBFUJYTCZ-VQQUBSRJSA-N |
| XLogP | 2.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|