About 4-amino-2,6-dichloro-3-methylphenol
4-amino-2,6-dichloro-3-methylphenol (PubChem CID 12039354) has the molecular formula C7H7Cl2NO
and a molecular weight of 192.04 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-3-methylphenol.
Molecular Properties
| Compound Name | 4-amino-2,6-dichloro-3-methylphenol |
| PubChem CID | 12039354 |
| Molecular Formula | C7H7Cl2NO |
| Molecular Weight | 192.04 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 4-amino-2,6-dichloro-3-methylphenol |
| SMILES | Cc1c(N)cc(Cl)c(O)c1Cl |
| InChI | InChI=1S/C7H7Cl2NO/c1-3-5(10)2-4(8)7(11)6(3)9/h2,11H,10H2,1H3 |
| InChIKey | UKDFVSCRHPFVOI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.04 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,6-dichloro-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-dichloro-3-methylphenol?
The IUPAC name of 4-amino-2,6-dichloro-3-methylphenol (CID 12039354) is 4-amino-2,6-dichloro-3-methylphenol.
What is the SMILES notation for 4-amino-2,6-dichloro-3-methylphenol?
The canonical SMILES for 4-amino-2,6-dichloro-3-methylphenol is Cc1c(N)cc(Cl)c(O)c1Cl.
What is the InChIKey of 4-amino-2,6-dichloro-3-methylphenol?
The InChIKey is UKDFVSCRHPFVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2NO/c1-3-5(10)2-4(8)7(11)6(3)9/h2,11H,10H2,1H3.
What are the key properties of 4-amino-2,6-dichloro-3-methylphenol?
4-amino-2,6-dichloro-3-methylphenol has a molecular weight of 192.04 g/mol, XLogP of 2.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-dichloro-3-methylphenol is sourced from PubChem (CID 12039354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).