About 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene
1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene (PubChem CID 12039851) has the molecular formula C16H25BrO4
and a molecular weight of 361.28 g/mol. Its IUPAC name is 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene |
| PubChem CID | 12039851 |
| Molecular Formula | C16H25BrO4 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene |
| SMILES | CCOC(C)OCc1ccc(Br)c(COC(C)OCC)c1 |
| InChI | InChI=1S/C16H25BrO4/c1-5-18-12(3)20-10-14-7-8-16(17)15(9-14)11-21-13(4)19-6-2/h7-9,12-13H,5-6,10-11H2,1-4H3 |
| InChIKey | JIWVDVBKPJFDBV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene?
The IUPAC name of 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene (CID 12039851) is 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene.
What is the SMILES notation for 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene?
The canonical SMILES for 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene is CCOC(C)OCc1ccc(Br)c(COC(C)OCC)c1.
What is the InChIKey of 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene?
The InChIKey is JIWVDVBKPJFDBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25BrO4/c1-5-18-12(3)20-10-14-7-8-16(17)15(9-14)11-21-13(4)19-6-2/h7-9,12-13H,5-6,10-11H2,1-4H3.
What are the key properties of 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene?
1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene has a molecular weight of 361.28 g/mol, XLogP of 4.25, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,4-bis(1-ethoxyethoxymethyl)benzene is sourced from PubChem (CID 12039851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).