About 2,5-bis(ethenoxy)-2,5-dimethylhexane
2,5-bis(ethenoxy)-2,5-dimethylhexane (PubChem CID 12040126) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,5-bis(ethenoxy)-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 2,5-bis(ethenoxy)-2,5-dimethylhexane |
| PubChem CID | 12040126 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,5-bis(ethenoxy)-2,5-dimethylhexane |
| SMILES | C=COC(C)(C)CCC(C)(C)OC=C |
| InChI | InChI=1S/C12H22O2/c1-7-13-11(3,4)9-10-12(5,6)14-8-2/h7-8H,1-2,9-10H2,3-6H3 |
| InChIKey | KFJSGJUUBISHBN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(ethenoxy)-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(ethenoxy)-2,5-dimethylhexane?
The IUPAC name of 2,5-bis(ethenoxy)-2,5-dimethylhexane (CID 12040126) is 2,5-bis(ethenoxy)-2,5-dimethylhexane.
What is the SMILES notation for 2,5-bis(ethenoxy)-2,5-dimethylhexane?
The canonical SMILES for 2,5-bis(ethenoxy)-2,5-dimethylhexane is C=COC(C)(C)CCC(C)(C)OC=C.
What is the InChIKey of 2,5-bis(ethenoxy)-2,5-dimethylhexane?
The InChIKey is KFJSGJUUBISHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-7-13-11(3,4)9-10-12(5,6)14-8-2/h7-8H,1-2,9-10H2,3-6H3.
What are the key properties of 2,5-bis(ethenoxy)-2,5-dimethylhexane?
2,5-bis(ethenoxy)-2,5-dimethylhexane has a molecular weight of 198.31 g/mol, XLogP of 3.64, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(ethenoxy)-2,5-dimethylhexane is sourced from PubChem (CID 12040126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).