C10H8F8O — CID 12040131
2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 12040131) has the molecular formula C10H8F8O and a molecular weight of 296.16 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 12040131 |
| Molecular Formula | C10H8F8O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | OC1CC2CC1C1(F)C(F)(F)C(F)(F)C(F)(F)C21F |
| InChI | InChI=1S/C10H8F8O/c11-6-3-1-4(5(19)2-3)7(6,12)9(15,16)10(17,18)8(6,13)14/h3-5,19H,1-2H2 |
| InChIKey | RGJOHXUFFNQOSG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|