C10H6F8 — CID 12040132
2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 12040132) has the molecular formula C10H6F8 and a molecular weight of 278.14 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 12040132 |
| Molecular Formula | C10H6F8 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2,3,3,4,4,5,5,6-octafluorotricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | FC1(F)C(F)(F)C2(F)C3C=CC(C3)C2(F)C1(F)F |
| InChI | InChI=1S/C10H6F8/c11-6-4-1-2-5(3-4)7(6,12)9(15,16)10(17,18)8(6,13)14/h1-2,4-5H,3H2 |
| InChIKey | JRTNBFDBMDMYAL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|