C13H13F4N5 — CID 12040371
6-(1-fluoroethyl)-2-N-[1-(3,4,5-trifluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 12040371) has the molecular formula C13H13F4N5 and a molecular weight of 315.27 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-2-N-[1-(3,4,5-trifluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-fluoroethyl)-2-N-[1-(3,4,5-trifluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 12040371 |
| Molecular Formula | C13H13F4N5 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 6-(1-fluoroethyl)-2-N-[1-(3,4,5-trifluorophenyl)ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(F)c1nc(N)nc(NC(C)c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H13F4N5/c1-5(14)11-20-12(18)22-13(21-11)19-6(2)7-3-8(15)10(17)9(16)4-7/h3-6H,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | RJPRRASLZYLQJU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|