C35HF25 — CID 12040501
1,2,3,4,5-pentafluoro-6-[2,3,4,5-tetrakis(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,4-dien-1-yl]benzene (PubChem CID 12040501) has the molecular formula C35HF25 and a molecular weight of 896.34 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,3,4,5-tetrakis(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,4-dien-1-yl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,3,4,5-tetrakis(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 12040501 |
| Molecular Formula | C35HF25 |
| Molecular Weight | 896.34 g/mol |
| Exact Mass | 895.97 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,3,4,5-tetrakis(2,3,4,5,6-pentafluorophenyl)cyclopenta-1,4-dien-1-yl]benzene |
| SMILES | Fc1c(F)c(F)c(C2=C(c3c(F)c(F)c(F)c(F)c3F)C(c3c(F)c(F)c(F)c(F)c3F)C(c3c(F)c(F)c(F)c(F)c3F)=C2c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C35HF25/c36-11-6(12(37)22(47)31(56)21(11)46)1-2(7-13(38)23(48)32(57)24(49)14(7)39)4(9-17(42)27(52)34(59)28(53)18(9)43)5(10-19(44)29(54)35(60)30(55)20(10)45)3(1)8-15(40)25(50)33(58)26(51)16(8)41/h1H |
| InChIKey | HNOYYEQPYCTQNP-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.34 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|