C9H4BrF7 — CID 12040578
1-bromo-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 12040578) has the molecular formula C9H4BrF7 and a molecular weight of 325.02 g/mol. Its IUPAC name is 1-bromo-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1-bromo-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 12040578 |
| Molecular Formula | C9H4BrF7 |
| Molecular Weight | 325.02 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 1-bromo-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | FC(F)(F)C(F)(c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C9H4BrF7/c10-6-3-1-2-5(4-6)7(11,8(12,13)14)9(15,16)17/h1-4H |
| InChIKey | LORVCBHYPNKHCQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.02 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |