C11H9F7S — CID 12040597
1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-methylsulfanylbenzene (PubChem CID 12040597) has the molecular formula C11H9F7S and a molecular weight of 306.25 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-methylsulfanylbenzene.
| Compound Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 12040597 |
| Molecular Formula | C11H9F7S |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-4-methylsulfanylbenzene |
| SMILES | CSc1ccc(C(F)(C(F)(F)F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C11H9F7S/c1-6-5-7(19-2)3-4-8(6)9(12,10(13,14)15)11(16,17)18/h3-5H,1-2H3 |
| InChIKey | DFDHHWDTFWWINM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |