C31H32F2N2O2 — CID 12041103
(4S)-4-(3,4-difluorophenyl)-3-(5-spiro[fluorene-9,4'-piperidine]-1'-ylpentyl)-1,3-oxazolidin-2-one (PubChem CID 12041103) has the molecular formula C31H32F2N2O2 and a molecular weight of 502.61 g/mol. Its IUPAC name is (4S)-4-(3,4-difluorophenyl)-3-(5-spiro[fluorene-9,4'-piperidine]-1'-ylpentyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(3,4-difluorophenyl)-3-(5-spiro[fluorene-9,4'-piperidine]-1'-ylpentyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 12041103 |
| Molecular Formula | C31H32F2N2O2 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (4S)-4-(3,4-difluorophenyl)-3-(5-spiro[fluorene-9,4'-piperidine]-1'-ylpentyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccc(F)c(F)c2)N1CCCCCN1CCC2(CC1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C31H32F2N2O2/c32-27-13-12-22(20-28(27)33)29-21-37-30(36)35(29)17-7-1-6-16-34-18-14-31(15-19-34)25-10-4-2-8-23(25)24-9-3-5-11-26(24)31/h2-5,8-13,20,29H,1,6-7,14-19,21H2/t29-/m1/s1 |
| InChIKey | MJGGXSPYGDDWGL-GDLZYMKVSA-N |
| XLogP | 6.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|