About 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate
6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate (PubChem CID 12041264) has the molecular formula C17H21NO6
and a molecular weight of 335.36 g/mol. Its IUPAC name is 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate.
Molecular Properties
| Compound Name | 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate |
| PubChem CID | 12041264 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CCc2c(C(C)=O)cc(C(=O)OC(C)(C)C)c(=O)n21 |
| InChI | InChI=1S/C17H21NO6/c1-9(19)10-8-11(15(21)24-17(2,3)4)14(20)18-12(10)6-7-13(18)16(22)23-5/h8,13H,6-7H2,1-5H3/t13-/m0/s1 |
| InChIKey | DEADBCZGCNVOCT-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate?
The IUPAC name of 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate (CID 12041264) is 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate.
What is the SMILES notation for 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate?
The canonical SMILES for 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate is COC(=O)[C@@H]1CCc2c(C(C)=O)cc(C(=O)OC(C)(C)C)c(=O)n21.
What is the InChIKey of 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate?
The InChIKey is DEADBCZGCNVOCT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H21NO6/c1-9(19)10-8-11(15(21)24-17(2,3)4)14(20)18-12(10)6-7-13(18)16(22)23-5/h8,13H,6-7H2,1-5H3/t13-/m0/s1.
What are the key properties of 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate?
6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate has a molecular weight of 335.36 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-tert-butyl 3-O-methyl (3S)-8-acetyl-5-oxo-2,3-dihydro-1H-indolizine-3,6-dicarboxylate is sourced from PubChem (CID 12041264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).