C16H22N2 — CID 12041429
(5aS,6aS,10aR)-4,7-dimethyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinoline (PubChem CID 12041429) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (5aS,6aS,10aR)-4,7-dimethyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aS,10aR)-4,7-dimethyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 12041429 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (5aS,6aS,10aR)-4,7-dimethyl-5,5a,6,6a,8,9,10,10a-octahydroindolo[4,3-fg]quinoline |
| SMILES | CN1C[C@H]2C[C@H]3[C@H](CCCN3C)c3cccc1c32 |
| InChI | InChI=1S/C16H22N2/c1-17-8-4-6-12-13-5-3-7-14-16(13)11(9-15(12)17)10-18(14)2/h3,5,7,11-12,15H,4,6,8-10H2,1-2H3/t11-,12-,15+/m1/s1 |
| InChIKey | AJLDKAZVAGCTKS-JMSVASOKSA-N |
| XLogP | 2.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |