C18H34N3O2+ — CID 12041646
tert-butyl N-[(2S)-1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-4-methylpentan-2-yl]carbamate (PubChem CID 12041646) has the molecular formula C18H34N3O2+ and a molecular weight of 324.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 12041646 |
| Molecular Formula | C18H34N3O2+ |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)C[C@@H](CN1CCC[N+]2=C1CCC2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33N3O2/c1-14(2)12-15(19-17(22)23-18(3,4)5)13-21-11-7-10-20-9-6-8-16(20)21/h14-15H,6-13H2,1-5H3/p+1/t15-/m0/s1 |
| InChIKey | BOMWXBONAYFQPL-HNNXBMFYSA-O |
| XLogP | 2.84 |
| TPSA | 44.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|