About [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate
[3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate (PubChem CID 12041812) has the molecular formula C14H16F3N3O3S
and a molecular weight of 363.36 g/mol. Its IUPAC name is [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate |
| PubChem CID | 12041812 |
| Molecular Formula | C14H16F3N3O3S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate |
| SMILES | CN1CCC(c2c[nH]c3ccc(OS(=O)(=O)C(F)(F)F)nc23)CC1 |
| InChI | InChI=1S/C14H16F3N3O3S/c1-20-6-4-9(5-7-20)10-8-18-11-2-3-12(19-13(10)11)23-24(21,22)14(15,16)17/h2-3,8-9,18H,4-7H2,1H3 |
| InChIKey | BNABGEMRGNXSMW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate?
The IUPAC name of [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate (CID 12041812) is [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate.
What is the SMILES notation for [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate?
The canonical SMILES for [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate is CN1CCC(c2c[nH]c3ccc(OS(=O)(=O)C(F)(F)F)nc23)CC1.
What is the InChIKey of [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate?
The InChIKey is BNABGEMRGNXSMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N3O3S/c1-20-6-4-9(5-7-20)10-8-18-11-2-3-12(19-13(10)11)23-24(21,22)14(15,16)17/h2-3,8-9,18H,4-7H2,1H3.
What are the key properties of [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate?
[3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate has a molecular weight of 363.36 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1-methylpiperidin-4-yl)-1H-pyrrolo[3,2-b]pyridin-5-yl] trifluoromethanesulfonate is sourced from PubChem (CID 12041812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).