C30H54O6 — CID 12041832
(2E,10E,14E,22E)-2,6,10,15,19,23-hexamethyltetracosa-2,10,14,22-tetraene-1,6,7,18,19,24-hexol (PubChem CID 12041832) has the molecular formula C30H54O6 and a molecular weight of 510.76 g/mol. Its IUPAC name is (2E,10E,14E,22E)-2,6,10,15,19,23-hexamethyltetracosa-2,10,14,22-tetraene-1,6,7,18,19,24-hexol.
| Compound Name | (2E,10E,14E,22E)-2,6,10,15,19,23-hexamethyltetracosa-2,10,14,22-tetraene-1,6,7,18,19,24-hexol |
|---|---|
| PubChem CID | 12041832 |
| Molecular Formula | C30H54O6 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | (2E,10E,14E,22E)-2,6,10,15,19,23-hexamethyltetracosa-2,10,14,22-tetraene-1,6,7,18,19,24-hexol |
| SMILES | C/C(=C\CCC(C)(O)C(O)CC/C(C)=C/CC/C=C(\C)CCC(O)C(C)(O)CC/C=C(\C)CO)CO |
| InChI | InChI=1S/C30H54O6/c1-23(15-17-27(33)29(5,35)19-9-13-25(3)21-31)11-7-8-12-24(2)16-18-28(34)30(6,36)20-10-14-26(4)22-32/h11-14,27-28,31-36H,7-10,15-22H2,1-6H3/b23-11+,24-12+,25-13+,26-14+ |
| InChIKey | VZNMYFXGBPEORA-VUHAMLAFSA-N |
| XLogP | 4.88 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|