C19H32O5Si — CID 12041839
methyl (4R,4aS,8S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate (PubChem CID 12041839) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is methyl (4R,4aS,8S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4R,4aS,8S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 12041839 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | methyl (4R,4aS,8S)-4-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-8-methyl-5-oxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CC[C@](C)(O)C1=CCC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O5Si/c1-17(2,3)25(6,7)24-15-10-8-9-13-18(4,22)12-11-14(20)19(13,15)16(21)23-5/h9,15,22H,8,10-12H2,1-7H3/t15-,18+,19-/m1/s1 |
| InChIKey | NHQQNICOWKYTJH-AYOQOUSVSA-N |
| XLogP | 3.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|