C24H48O4Si2 — CID 12041949
(1S,3S,4S,5R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-1-ethenyl-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-ol (PubChem CID 12041949) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is (1S,3S,4S,5R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-1-ethenyl-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-ol.
| Compound Name | (1S,3S,4S,5R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-1-ethenyl-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-ol |
|---|---|
| PubChem CID | 12041949 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | (1S,3S,4S,5R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-triethylsilyloxyethyl]-1-ethenyl-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-3-ol |
| SMILES | C=C[C@]12O[C@H](O)[C@H]([C@@H](CO[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C)[C@H]1CC2(C)C |
| InChI | InChI=1S/C24H48O4Si2/c1-12-24-18(16-23(24,8)9)20(21(25)27-24)19(28-29(10,11)22(5,6)7)17-26-30(13-2,14-3)15-4/h12,18-21,25H,1,13-17H2,2-11H3/t18-,19-,20+,21+,24+/m1/s1 |
| InChIKey | RUDVRYGWQBTASX-RUFWAXPRSA-N |
| XLogP | 6.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|