C12H16O4 — CID 12042023
2-[(3aS,4R,7R,7aR)-7-ethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl]acetic acid (PubChem CID 12042023) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(3aS,4R,7R,7aR)-7-ethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl]acetic acid.
| Compound Name | 2-[(3aS,4R,7R,7aR)-7-ethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl]acetic acid |
|---|---|
| PubChem CID | 12042023 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[(3aS,4R,7R,7aR)-7-ethyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl]acetic acid |
| SMILES | CC[C@@H]1C=C[C@@H](CC(=O)O)[C@@H]2CC(=O)O[C@@H]21 |
| InChI | InChI=1S/C12H16O4/c1-2-7-3-4-8(5-10(13)14)9-6-11(15)16-12(7)9/h3-4,7-9,12H,2,5-6H2,1H3,(H,13,14)/t7-,8+,9+,12-/m1/s1 |
| InChIKey | MURFOVWXNXCUNB-JDVQERKKSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|