C25H31N3O5 — CID 12042482
(2S)-2-[(1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carbonyl)amino]-3-(4-pentoxyphenyl)propanoic acid (PubChem CID 12042482) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (2S)-2-[(1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carbonyl)amino]-3-(4-pentoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[(1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carbonyl)amino]-3-(4-pentoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 12042482 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (2S)-2-[(1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carbonyl)amino]-3-(4-pentoxyphenyl)propanoic acid |
| SMILES | CCCCCOc1ccc(C[C@H](NC(=O)C2CC(=O)N(C)C2c2cccnc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-3-4-5-13-33-19-10-8-17(9-11-19)14-21(25(31)32)27-24(30)20-15-22(29)28(2)23(20)18-7-6-12-26-16-18/h6-12,16,20-21,23H,3-5,13-15H2,1-2H3,(H,27,30)(H,31,32)/t20?,21-,23?/m0/s1 |
| InChIKey | SAWNEBBEUABBIH-QKDPSFTKSA-N |
| XLogP | 2.98 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|