About 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one
5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 12042978) has the molecular formula C19H18ClNO
and a molecular weight of 311.81 g/mol. Its IUPAC name is 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one |
| PubChem CID | 12042978 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | O=C1Nc2ccc(-c3cccc(Cl)c3)cc2C12CCCCC2 |
| InChI | InChI=1S/C19H18ClNO/c20-15-6-4-5-13(11-15)14-7-8-17-16(12-14)19(18(22)21-17)9-2-1-3-10-19/h4-8,11-12H,1-3,9-10H2,(H,21,22) |
| InChIKey | XVGXCHRWZFIARX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one?
The IUPAC name of 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one (CID 12042978) is 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one.
What is the SMILES notation for 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one?
The canonical SMILES for 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one is O=C1Nc2ccc(-c3cccc(Cl)c3)cc2C12CCCCC2.
What is the InChIKey of 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one?
The InChIKey is XVGXCHRWZFIARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO/c20-15-6-4-5-13(11-15)14-7-8-17-16(12-14)19(18(22)21-17)9-2-1-3-10-19/h4-8,11-12H,1-3,9-10H2,(H,21,22).
What are the key properties of 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one?
5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one has a molecular weight of 311.81 g/mol, XLogP of 5.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)spiro[1H-indole-3,1'-cyclohexane]-2-one is sourced from PubChem (CID 12042978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).