About 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione
2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione (PubChem CID 12043026) has the molecular formula C9H10O4
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione |
| PubChem CID | 12043026 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione |
| SMILES | CC1(C)OCC2(O1)C(=O)C=CC2=O |
| InChI | InChI=1S/C9H10O4/c1-8(2)12-5-9(13-8)6(10)3-4-7(9)11/h3-4H,5H2,1-2H3 |
| InChIKey | UIPFLTAMWQPKHY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione?
The IUPAC name of 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione (CID 12043026) is 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione.
What is the SMILES notation for 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione?
The canonical SMILES for 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione is CC1(C)OCC2(O1)C(=O)C=CC2=O.
What is the InChIKey of 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione?
The InChIKey is UIPFLTAMWQPKHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-8(2)12-5-9(13-8)6(10)3-4-7(9)11/h3-4H,5H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione?
2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione has a molecular weight of 182.18 g/mol, XLogP of 0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-ene-6,9-dione is sourced from PubChem (CID 12043026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).