About 2-cyclohexyloxy-6,7-dimethoxyquinoxaline
2-cyclohexyloxy-6,7-dimethoxyquinoxaline (PubChem CID 12043218) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-cyclohexyloxy-6,7-dimethoxyquinoxaline.
Molecular Properties
| Compound Name | 2-cyclohexyloxy-6,7-dimethoxyquinoxaline |
| PubChem CID | 12043218 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-cyclohexyloxy-6,7-dimethoxyquinoxaline |
| SMILES | COc1cc2ncc(OC3CCCCC3)nc2cc1OC |
| InChI | InChI=1S/C16H20N2O3/c1-19-14-8-12-13(9-15(14)20-2)18-16(10-17-12)21-11-6-4-3-5-7-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | BEFUAVPFBGOHKT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclohexyloxy-6,7-dimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxy-6,7-dimethoxyquinoxaline?
The IUPAC name of 2-cyclohexyloxy-6,7-dimethoxyquinoxaline (CID 12043218) is 2-cyclohexyloxy-6,7-dimethoxyquinoxaline.
What is the SMILES notation for 2-cyclohexyloxy-6,7-dimethoxyquinoxaline?
The canonical SMILES for 2-cyclohexyloxy-6,7-dimethoxyquinoxaline is COc1cc2ncc(OC3CCCCC3)nc2cc1OC.
What is the InChIKey of 2-cyclohexyloxy-6,7-dimethoxyquinoxaline?
The InChIKey is BEFUAVPFBGOHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-19-14-8-12-13(9-15(14)20-2)18-16(10-17-12)21-11-6-4-3-5-7-11/h8-11H,3-7H2,1-2H3.
What are the key properties of 2-cyclohexyloxy-6,7-dimethoxyquinoxaline?
2-cyclohexyloxy-6,7-dimethoxyquinoxaline has a molecular weight of 288.35 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxy-6,7-dimethoxyquinoxaline is sourced from PubChem (CID 12043218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).