About 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole
2-(1,2,4-triazol-1-yl)-1,3-benzoxazole (PubChem CID 1204337) has the molecular formula C9H6N4O
and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole |
| PubChem CID | 1204337 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole |
| SMILES | c1ccc2oc(-n3cncn3)nc2c1 |
| InChI | InChI=1S/C9H6N4O/c1-2-4-8-7(3-1)12-9(14-8)13-6-10-5-11-13/h1-6H |
| InChIKey | MWVVLUGDCGDNRB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole?
The IUPAC name of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole (CID 1204337) is 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole is c1ccc2oc(-n3cncn3)nc2c1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole?
The InChIKey is MWVVLUGDCGDNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O/c1-2-4-8-7(3-1)12-9(14-8)13-6-10-5-11-13/h1-6H.
What are the key properties of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole?
2-(1,2,4-triazol-1-yl)-1,3-benzoxazole has a molecular weight of 186.17 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole is sourced from PubChem (CID 1204337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).