About dibenzothiophene-2,8-diol
dibenzothiophene-2,8-diol (PubChem CID 1204339) has the molecular formula C12H8O2S
and a molecular weight of 216.26 g/mol. Its IUPAC name is dibenzothiophene-2,8-diol.
Molecular Properties
| Compound Name | dibenzothiophene-2,8-diol |
| PubChem CID | 1204339 |
| Molecular Formula | C12H8O2S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | dibenzothiophene-2,8-diol |
| SMILES | Oc1ccc2sc3ccc(O)cc3c2c1 |
| InChI | InChI=1S/C12H8O2S/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,13-14H |
| InChIKey | ORACUDSQEWJAQK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dibenzothiophene-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzothiophene-2,8-diol?
The IUPAC name of dibenzothiophene-2,8-diol (CID 1204339) is dibenzothiophene-2,8-diol.
What is the SMILES notation for dibenzothiophene-2,8-diol?
The canonical SMILES for dibenzothiophene-2,8-diol is Oc1ccc2sc3ccc(O)cc3c2c1.
What is the InChIKey of dibenzothiophene-2,8-diol?
The InChIKey is ORACUDSQEWJAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2S/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,13-14H.
What are the key properties of dibenzothiophene-2,8-diol?
dibenzothiophene-2,8-diol has a molecular weight of 216.26 g/mol, XLogP of 3.47, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzothiophene-2,8-diol is sourced from PubChem (CID 1204339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).