C28H42O5 — CID 12043523
(2R,4S,4aR,6aR,6aR,6bS,8S,11S,12aS,14aS,14bR)-4,8,11-trihydroxy-2,4a,6a,6a,9,14a-hexamethyl-1,2,4,5,6,6b,7,8,11,12,12a,13,14,14b-tetradecahydropicene-3,10-dione (PubChem CID 12043523) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is (2R,4S,4aR,6aR,6aR,6bS,8S,11S,12aS,14aS,14bR)-4,8,11-trihydroxy-2,4a,6a,6a,9,14a-hexamethyl-1,2,4,5,6,6b,7,8,11,12,12a,13,14,14b-tetradecahydropicene-3,10-dione.
| Compound Name | (2R,4S,4aR,6aR,6aR,6bS,8S,11S,12aS,14aS,14bR)-4,8,11-trihydroxy-2,4a,6a,6a,9,14a-hexamethyl-1,2,4,5,6,6b,7,8,11,12,12a,13,14,14b-tetradecahydropicene-3,10-dione |
|---|---|
| PubChem CID | 12043523 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (2R,4S,4aR,6aR,6aR,6bS,8S,11S,12aS,14aS,14bR)-4,8,11-trihydroxy-2,4a,6a,6a,9,14a-hexamethyl-1,2,4,5,6,6b,7,8,11,12,12a,13,14,14b-tetradecahydropicene-3,10-dione |
| SMILES | CC1=C2[C@@H](C[C@H](O)C1=O)[C@]1(C)CC[C@@]3(C)[C@H]4C[C@@H](C)C(=O)[C@@H](O)[C@]4(C)CC[C@]3(C)[C@H]1C[C@@H]2O |
| InChI | InChI=1S/C28H42O5/c1-14-11-19-26(4,24(33)22(14)31)8-10-28(6)20-13-17(29)21-15(2)23(32)18(30)12-16(21)25(20,3)7-9-27(19,28)5/h14,16-20,24,29-30,33H,7-13H2,1-6H3/t14-,16-,17+,18+,19+,20+,24-,25+,26-,27+,28-/m1/s1 |
| InChIKey | OULQBFCIZRSZEA-PJHNONFPSA-N |
| XLogP | 3.83 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |