C16H15F4NO2 — CID 12043697
2-[(1R)-1-cyclohexylethyl]-4,5,6,7-tetrafluoroisoindole-1,3-dione (PubChem CID 12043697) has the molecular formula C16H15F4NO2 and a molecular weight of 329.29 g/mol. Its IUPAC name is 2-[(1R)-1-cyclohexylethyl]-4,5,6,7-tetrafluoroisoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-cyclohexylethyl]-4,5,6,7-tetrafluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 12043697 |
| Molecular Formula | C16H15F4NO2 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[(1R)-1-cyclohexylethyl]-4,5,6,7-tetrafluoroisoindole-1,3-dione |
| SMILES | C[C@H](C1CCCCC1)N1C(=O)c2c(F)c(F)c(F)c(F)c2C1=O |
| InChI | InChI=1S/C16H15F4NO2/c1-7(8-5-3-2-4-6-8)21-15(22)9-10(16(21)23)12(18)14(20)13(19)11(9)17/h7-8H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | OAJRZWJPYGFQRQ-SSDOTTSWSA-N |
| XLogP | 3.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|