C17H13NO5 — CID 12043736
5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl)isoindole-1,3-dione (PubChem CID 12043736) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl)isoindole-1,3-dione.
| Compound Name | 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 12043736 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-(5-methoxy-2,3-dihydro-1,4-benzodioxin-8-yl)isoindole-1,3-dione |
| SMILES | COc1ccc(-c2ccc3c(c2)C(=O)NC3=O)c2c1OCCO2 |
| InChI | InChI=1S/C17H13NO5/c1-21-13-5-4-10(14-15(13)23-7-6-22-14)9-2-3-11-12(8-9)17(20)18-16(11)19/h2-5,8H,6-7H2,1H3,(H,18,19,20) |
| InChIKey | BWRWNMJXWRCAQB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|