C21H14BrCl2NO — CID 12043741
3-[(4-bromophenyl)methyl]-1-(3,5-dichlorophenyl)-3H-indol-2-one (PubChem CID 12043741) has the molecular formula C21H14BrCl2NO and a molecular weight of 447.16 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-1-(3,5-dichlorophenyl)-3H-indol-2-one.
| Compound Name | 3-[(4-bromophenyl)methyl]-1-(3,5-dichlorophenyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 12043741 |
| Molecular Formula | C21H14BrCl2NO |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-1-(3,5-dichlorophenyl)-3H-indol-2-one |
| SMILES | O=C1C(Cc2ccc(Br)cc2)c2ccccc2N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C21H14BrCl2NO/c22-14-7-5-13(6-8-14)9-19-18-3-1-2-4-20(18)25(21(19)26)17-11-15(23)10-16(24)12-17/h1-8,10-12,19H,9H2 |
| InChIKey | REESSRWDWDSDPU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |