C35H47F5O4S — CID 12043770
ethyl 10-[(3R,4R)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate (PubChem CID 12043770) has the molecular formula C35H47F5O4S and a molecular weight of 658.81 g/mol. Its IUPAC name is ethyl 10-[(3R,4R)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate.
| Compound Name | ethyl 10-[(3R,4R)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate |
|---|---|
| PubChem CID | 12043770 |
| Molecular Formula | C35H47F5O4S |
| Molecular Weight | 658.81 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | ethyl 10-[(3R,4R)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate |
| SMILES | CCOC(=O)C(CCCCCCCC[C@H]1c2ccc(OC)cc2SC[C@@]1(C)c1ccc(OC)cc1)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H47F5O4S/c1-5-44-32(41)25(14-12-22-34(36,37)35(38,39)40)13-10-8-6-7-9-11-15-30-29-21-20-28(43-4)23-31(29)45-24-33(30,2)26-16-18-27(42-3)19-17-26/h16-21,23,25,30H,5-15,22,24H2,1-4H3/t25?,30-,33-/m0/s1 |
| InChIKey | FNLQSUQLEMMKGC-XUSACRBGSA-N |
| XLogP | 10.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.81 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|