C33H43F5O4S — CID 12043771
ethyl 10-[(3R,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate (PubChem CID 12043771) has the molecular formula C33H43F5O4S and a molecular weight of 630.76 g/mol. Its IUPAC name is ethyl 10-[(3R,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate.
| Compound Name | ethyl 10-[(3R,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate |
|---|---|
| PubChem CID | 12043771 |
| Molecular Formula | C33H43F5O4S |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | ethyl 10-[(3R,4R)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentyl)decanoate |
| SMILES | CCOC(=O)C(CCCCCCCC[C@H]1c2ccc(O)cc2SC[C@@]1(C)c1ccc(O)cc1)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H43F5O4S/c1-3-42-30(41)23(12-10-20-32(34,35)33(36,37)38)11-8-6-4-5-7-9-13-28-27-19-18-26(40)21-29(27)43-22-31(28,2)24-14-16-25(39)17-15-24/h14-19,21,23,28,39-40H,3-13,20,22H2,1-2H3/t23?,28-,31-/m0/s1 |
| InChIKey | ODUAWOUBQGJTFZ-DBZZRVTNSA-N |
| XLogP | 9.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|