About 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole
5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole (PubChem CID 12044213) has the molecular formula C10H9ClN2O
and a molecular weight of 208.65 g/mol. Its IUPAC name is 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole |
| PubChem CID | 12044213 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole |
| SMILES | ClCc1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C10H9ClN2O/c11-7-9-12-10(14-13-9)6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | XECLIXXHUYTYJD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole?
The IUPAC name of 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole (CID 12044213) is 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole.
What is the SMILES notation for 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole?
The canonical SMILES for 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole is ClCc1noc(Cc2ccccc2)n1.
What is the InChIKey of 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole?
The InChIKey is XECLIXXHUYTYJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O/c11-7-9-12-10(14-13-9)6-8-4-2-1-3-5-8/h1-5H,6-7H2.
What are the key properties of 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole?
5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole has a molecular weight of 208.65 g/mol, XLogP of 2.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole is sourced from PubChem (CID 12044213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).