C19H32O3Si — CID 12044257
(4S,4aR,8S,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethyl-4-hydroxy-4a,5,8,8a-tetrahydro-4H-naphthalen-1-one (PubChem CID 12044257) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (4S,4aR,8S,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethyl-4-hydroxy-4a,5,8,8a-tetrahydro-4H-naphthalen-1-one.
| Compound Name | (4S,4aR,8S,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethyl-4-hydroxy-4a,5,8,8a-tetrahydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 12044257 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (4S,4aR,8S,8aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-ethyl-4-hydroxy-4a,5,8,8a-tetrahydro-4H-naphthalen-1-one |
| SMILES | CC[C@H]1C=C(CO[Si](C)(C)C(C)(C)C)C[C@@H]2[C@H]1C(=O)C=C[C@@H]2O |
| InChI | InChI=1S/C19H32O3Si/c1-7-14-10-13(12-22-23(5,6)19(2,3)4)11-15-16(20)8-9-17(21)18(14)15/h8-10,14-16,18,20H,7,11-12H2,1-6H3/t14-,15-,16-,18-/m0/s1 |
| InChIKey | APQPCQFQFJPWBC-OVWQWFNUSA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|