C17H17F5N6O5S — CID 12044282
N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1-pyridinyl]acetamide (PubChem CID 12044282) has the molecular formula C17H17F5N6O5S and a molecular weight of 512.42 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1-pyridinyl]acetamide.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 12044282 |
| Molecular Formula | C17H17F5N6O5S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1-pyridinyl]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(=O)n1CC(=O)NCCON=C(N)N |
| InChI | InChI=1S/C17H17F5N6O5S/c1-7-2-3-8(16(30)28(7)6-9(29)25-4-5-33-26-17(23)24)27-34(31,32)15-13(21)11(19)10(18)12(20)14(15)22/h2-3,27H,4-6H2,1H3,(H,25,29)(H4,23,24,26) |
| InChIKey | RKIVGKPEGZDOKS-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|