About 1,4-difluorophthalazine
1,4-difluorophthalazine (PubChem CID 12045193) has the molecular formula C8H4F2N2
and a molecular weight of 166.13 g/mol. Its IUPAC name is 1,4-difluorophthalazine.
Molecular Properties
| Compound Name | 1,4-difluorophthalazine |
| PubChem CID | 12045193 |
| Molecular Formula | C8H4F2N2 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 1,4-difluorophthalazine |
| SMILES | Fc1nnc(F)c2ccccc12 |
| InChI | InChI=1S/C8H4F2N2/c9-7-5-3-1-2-4-6(5)8(10)12-11-7/h1-4H |
| InChIKey | UCIZVQUARONJGJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-difluorophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-difluorophthalazine?
The IUPAC name of 1,4-difluorophthalazine (CID 12045193) is 1,4-difluorophthalazine.
What is the SMILES notation for 1,4-difluorophthalazine?
The canonical SMILES for 1,4-difluorophthalazine is Fc1nnc(F)c2ccccc12.
What is the InChIKey of 1,4-difluorophthalazine?
The InChIKey is UCIZVQUARONJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F2N2/c9-7-5-3-1-2-4-6(5)8(10)12-11-7/h1-4H.
What are the key properties of 1,4-difluorophthalazine?
1,4-difluorophthalazine has a molecular weight of 166.13 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-difluorophthalazine is sourced from PubChem (CID 12045193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).