About 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium
1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium (PubChem CID 12046361) has the molecular formula C22H32N3+
and a molecular weight of 338.52 g/mol. Its IUPAC name is 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium.
Molecular Properties
| Compound Name | 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium |
| PubChem CID | 12046361 |
| Molecular Formula | C22H32N3+ |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium |
| SMILES | c1nn(C23CC4CC(CC(C4)C2)C3)c[n+]1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H32N3/c1-15-2-17-3-16(1)8-21(7-15,9-17)24-13-23-25(14-24)22-10-18-4-19(11-22)6-20(5-18)12-22/h13-20H,1-12H2/q+1 |
| InChIKey | LHFLZISAPJUXCT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium?
The IUPAC name of 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium (CID 12046361) is 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium.
What is the SMILES notation for 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium?
The canonical SMILES for 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium is c1nn(C23CC4CC(CC(C4)C2)C3)c[n+]1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium?
The InChIKey is LHFLZISAPJUXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N3/c1-15-2-17-3-16(1)8-21(7-15,9-17)24-13-23-25(14-24)22-10-18-4-19(11-22)6-20(5-18)12-22/h13-20H,1-12H2/q+1.
What are the key properties of 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium?
1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium has a molecular weight of 338.52 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(1-adamantyl)-1,2,4-triazol-4-ium is sourced from PubChem (CID 12046361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).