C22H20O3S — CID 12046703
8-(benzenesulfonyl)-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 12046703) has the molecular formula C22H20O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 12046703 |
| Molecular Formula | C22H20O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 8-(benzenesulfonyl)-3-phenyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | O=C1CC2=C(S(=O)(=O)c3ccccc3)CCCCC2=C1c1ccccc1 |
| InChI | InChI=1S/C22H20O3S/c23-20-15-19-18(22(20)16-9-3-1-4-10-16)13-7-8-14-21(19)26(24,25)17-11-5-2-6-12-17/h1-6,9-12H,7-8,13-15H2 |
| InChIKey | BXHIKTIMOMHJGL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |