C8H9F10NO2 — CID 12046721
2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine (PubChem CID 12046721) has the molecular formula C8H9F10NO2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 12046721 |
| Molecular Formula | C8H9F10NO2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethoxy)-N-[2-(1,1,2,2,2-pentafluoroethoxy)ethyl]ethanamine |
| SMILES | FC(F)(F)C(F)(F)OCCNCCOC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F10NO2/c9-5(10,11)7(15,16)20-3-1-19-2-4-21-8(17,18)6(12,13)14/h19H,1-4H2 |
| InChIKey | RAKJSWWBFGDHRE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|