C15H21NO5 — CID 12046737
diethyl (3R,6S)-3-acetamido-6-methylcyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 12046737) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is diethyl (3R,6S)-3-acetamido-6-methylcyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | diethyl (3R,6S)-3-acetamido-6-methylcyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 12046737 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | diethyl (3R,6S)-3-acetamido-6-methylcyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@H](NC(C)=O)C=C[C@@H]1C |
| InChI | InChI=1S/C15H21NO5/c1-5-20-14(18)12-9(3)7-8-11(16-10(4)17)13(12)15(19)21-6-2/h7-9,11H,5-6H2,1-4H3,(H,16,17)/t9-,11+/m0/s1 |
| InChIKey | LUNVKJPVLLHNKB-GXSJLCMTSA-N |
| XLogP | 1.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|