C29H23ClN2O3 — CID 12046753
(E)-N-(4-chlorophenyl)-4-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidin-1-yl]-4-oxobut-2-enamide (PubChem CID 12046753) has the molecular formula C29H23ClN2O3 and a molecular weight of 482.97 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-4-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidin-1-yl]-4-oxobut-2-enamide.
| Compound Name | (E)-N-(4-chlorophenyl)-4-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidin-1-yl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 12046753 |
| Molecular Formula | C29H23ClN2O3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-4-[(3E,5E)-3,5-dibenzylidene-4-oxopiperidin-1-yl]-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)N1C/C(=C\c2ccccc2)C(=O)/C(=C/c2ccccc2)C1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H23ClN2O3/c30-25-11-13-26(14-12-25)31-27(33)15-16-28(34)32-19-23(17-21-7-3-1-4-8-21)29(35)24(20-32)18-22-9-5-2-6-10-22/h1-18H,19-20H2,(H,31,33)/b16-15+,23-17+,24-18+ |
| InChIKey | YWPITMFVDLOJPD-PVZJMEAYSA-N |
| XLogP | 5.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|