C11H20N2O4S3 — CID 1204683
1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 1204683) has the molecular formula C11H20N2O4S3 and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 1204683 |
| Molecular Formula | C11H20N2O4S3 |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-3-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | C[C@]1(NC(=S)N[C@]2(C)CCS(=O)(=O)C2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O4S3/c1-10(3-5-19(14,15)7-10)12-9(18)13-11(2)4-6-20(16,17)8-11/h3-8H2,1-2H3,(H2,12,13,18)/t10-,11+ |
| InChIKey | UTJZNGDRQSEGPQ-PHIMTYICSA-N |
| XLogP | -0.40 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|