C6H3N5O4 — CID 1204689
6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 1204689) has the molecular formula C6H3N5O4 and a molecular weight of 209.12 g/mol. Its IUPAC name is 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 1204689 |
| Molecular Formula | C6H3N5O4 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 6-nitro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2ncc([N+](=O)[O-])cn2n1 |
| InChI | InChI=1S/C6H3N5O4/c12-5(13)4-8-6-7-1-3(11(14)15)2-10(6)9-4/h1-2H,(H,12,13) |
| InChIKey | XRDVVRBMLDUXMD-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|