C20H14N2O5 — CID 12046912
ethyl 1,2,4-trioxo-5-phenylpyrrolo[1,2-a]quinoxaline-3-carboxylate (PubChem CID 12046912) has the molecular formula C20H14N2O5 and a molecular weight of 362.34 g/mol. Its IUPAC name is ethyl 1,2,4-trioxo-5-phenylpyrrolo[1,2-a]quinoxaline-3-carboxylate.
| Compound Name | ethyl 1,2,4-trioxo-5-phenylpyrrolo[1,2-a]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 12046912 |
| Molecular Formula | C20H14N2O5 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | ethyl 1,2,4-trioxo-5-phenylpyrrolo[1,2-a]quinoxaline-3-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=O)N(c3ccccc3)c3ccccc3N2C(=O)C1=O |
| InChI | InChI=1S/C20H14N2O5/c1-2-27-20(26)15-16-18(24)21(12-8-4-3-5-9-12)13-10-6-7-11-14(13)22(16)19(25)17(15)23/h3-11H,2H2,1H3 |
| InChIKey | UYQNZIZPRBLFLQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|